C28H29N7OS — CID 100778736
1-[4-(1,3-dihydroisoindol-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 100778736) has the molecular formula C28H29N7OS and a molecular weight of 511.66 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100778736 |
| Molecular Formula | C28H29N7OS |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccco1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C28H29N7OS/c37-28(29-18-24-11-6-16-36-24)32-27-30-25(34-14-12-33(13-15-34)23-9-2-1-3-10-23)17-26(31-27)35-19-21-7-4-5-8-22(21)20-35/h1-11,16-17H,12-15,18-20H2,(H2,29,30,31,32,37) |
| InChIKey | QXHJIMYURHBWIA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|