C33H37N7S — CID 100785623
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea (PubChem CID 100785623) has the molecular formula C33H37N7S and a molecular weight of 563.78 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785623 |
| Molecular Formula | C33H37N7S |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
| SMILES | S=C(NCCCc1ccccc1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C33H37N7S/c41-33(34-18-9-12-26-10-3-1-4-11-26)37-32-35-30(39-22-20-38(21-23-39)29-15-5-2-6-16-29)24-31(36-32)40-19-17-27-13-7-8-14-28(27)25-40/h1-8,10-11,13-16,24H,9,12,17-23,25H2,(H2,34,35,36,37,41) |
| InChIKey | JOWAPUCCRKTYNL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|