C24H34N6OS — CID 100785520
1-[4-(azepan-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(3-phenylpropyl)thiourea (PubChem CID 100785520) has the molecular formula C24H34N6OS and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785520 |
| Molecular Formula | C24H34N6OS |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
| SMILES | S=C(NCCCc1ccccc1)Nc1nc(N2CCCCCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H34N6OS/c32-24(25-12-8-11-20-9-4-3-5-10-20)28-23-26-21(29-13-6-1-2-7-14-29)19-22(27-23)30-15-17-31-18-16-30/h3-5,9-10,19H,1-2,6-8,11-18H2,(H2,25,26,27,28,32) |
| InChIKey | UWRXKPZJAXXOOI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|