C24H27N5O2S — CID 100785522
1-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea (PubChem CID 100785522) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is 1-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785522 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea |
| SMILES | S=C(NCCCc1ccccc1)Nc1nc(Oc2ccccc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H27N5O2S/c32-24(25-13-7-10-19-8-3-1-4-9-19)28-23-26-21(29-14-16-30-17-15-29)18-22(27-23)31-20-11-5-2-6-12-20/h1-6,8-9,11-12,18H,7,10,13-17H2,(H2,25,26,27,28,32) |
| InChIKey | BUJNTVMAUCIXOG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|