C16H18ClN5OS — CID 100780982
1-benzyl-3-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)thiourea (PubChem CID 100780982) has the molecular formula C16H18ClN5OS and a molecular weight of 363.87 g/mol. Its IUPAC name is 1-benzyl-3-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-benzyl-3-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100780982 |
| Molecular Formula | C16H18ClN5OS |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-benzyl-3-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCc1ccccc1)Nc1nc(Cl)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H18ClN5OS/c17-13-10-14(22-6-8-23-9-7-22)20-15(19-13)21-16(24)18-11-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H2,18,19,20,21,24) |
| InChIKey | ZNLBOFFBISERTR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|