C21H22ClN7S — CID 100782574
1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782574) has the molecular formula C21H22ClN7S and a molecular weight of 439.98 g/mol. Its IUPAC name is 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782574 |
| Molecular Formula | C21H22ClN7S |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-[4-chloro-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccnc1)Nc1nc(Cl)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H22ClN7S/c22-18-13-19(29-11-9-28(10-12-29)17-6-2-1-3-7-17)26-20(25-18)27-21(30)24-15-16-5-4-8-23-14-16/h1-8,13-14H,9-12,15H2,(H2,24,25,26,27,30) |
| InChIKey | CNLDLKLFQSRHNP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|