C23H23F3N6S — CID 100780968
1-benzyl-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100780968) has the molecular formula C23H23F3N6S and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-benzyl-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-benzyl-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100780968 |
| Molecular Formula | C23H23F3N6S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-benzyl-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)NCc2ccccc2)n1 |
| InChI | InChI=1S/C23H23F3N6S/c24-23(25,26)19-15-20(32-13-11-31(12-14-32)18-9-5-2-6-10-18)29-21(28-19)30-22(33)27-16-17-7-3-1-4-8-17/h1-10,15H,11-14,16H2,(H2,27,28,29,30,33) |
| InChIKey | BRKOORCUZLJANG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|