C25H30N8OS — CID 100782311
1-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782311) has the molecular formula C25H30N8OS and a molecular weight of 490.64 g/mol. Its IUPAC name is 1-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782311 |
| Molecular Formula | C25H30N8OS |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-[4-morpholin-4-yl-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | S=C(NCc1cccnc1)Nc1nc(N2CCOCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H30N8OS/c35-25(27-19-20-5-4-8-26-18-20)30-24-28-22(17-23(29-24)33-13-15-34-16-14-33)32-11-9-31(10-12-32)21-6-2-1-3-7-21/h1-8,17-18H,9-16,19H2,(H2,27,28,29,30,35) |
| InChIKey | HLDNGTBTWVZRDM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|