C21H29N7OS — CID 100782300
1-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782300) has the molecular formula C21H29N7OS and a molecular weight of 427.58 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782300 |
| Molecular Formula | C21H29N7OS |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(N2CCOCC2)nc(NC(=S)NCc2cccnc2)n1 |
| InChI | InChI=1S/C21H29N7OS/c1-16-5-2-3-8-28(16)19-13-18(27-9-11-29-12-10-27)24-20(25-19)26-21(30)23-15-17-6-4-7-22-14-17/h4,6-7,13-14,16H,2-3,5,8-12,15H2,1H3,(H2,23,24,25,26,30)/t16-/m0/s1 |
| InChIKey | HYXHLVRIZWDRQH-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|