C22H31N7S — CID 100782264
1-[4-[(2R)-2-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782264) has the molecular formula C22H31N7S and a molecular weight of 425.61 g/mol. Its IUPAC name is 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782264 |
| Molecular Formula | C22H31N7S |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(N2CCCCC2)nc(NC(=S)NCc2cccnc2)n1 |
| InChI | InChI=1S/C22H31N7S/c1-17-8-3-6-13-29(17)20-14-19(28-11-4-2-5-12-28)25-21(26-20)27-22(30)24-16-18-9-7-10-23-15-18/h7,9-10,14-15,17H,2-6,8,11-13,16H2,1H3,(H2,24,25,26,27,30)/t17-/m1/s1 |
| InChIKey | ZUUDMZOMZLDLBM-QGZVFWFLSA-N |
| XLogP | 3.73 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|