C23H32N6O2S — CID 100781132
1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100781132) has the molecular formula C23H32N6O2S and a molecular weight of 456.62 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100781132 |
| Molecular Formula | C23H32N6O2S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(N3CCOCC3)cc(N3CCCC[C@@H]3C)n2)cc1 |
| InChI | InChI=1S/C23H32N6O2S/c1-17-5-3-4-10-29(17)21-15-20(28-11-13-31-14-12-28)25-22(26-21)27-23(32)24-16-18-6-8-19(30-2)9-7-18/h6-9,15,17H,3-5,10-14,16H2,1-2H3,(H2,24,25,26,27,32)/t17-/m0/s1 |
| InChIKey | SKTNSAQXTJLBFJ-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|