C17H20ClN5O2S — CID 100781363
1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 100781363) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100781363 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(Cl)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H20ClN5O2S/c1-24-13-4-2-12(3-5-13)11-19-17(26)22-16-20-14(18)10-15(21-16)23-6-8-25-9-7-23/h2-5,10H,6-9,11H2,1H3,(H2,19,20,21,22,26) |
| InChIKey | PFCXYBYKCLCYQQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|