C17H20ClN5OS — CID 100781358
1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 100781358) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100781358 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(Cl)cc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C17H20ClN5OS/c1-24-13-6-4-12(5-7-13)11-19-17(25)22-16-20-14(18)10-15(21-16)23-8-2-3-9-23/h4-7,10H,2-3,8-9,11H2,1H3,(H2,19,20,21,22,25) |
| InChIKey | JVRWGPCSGOHITJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|