C17H19Cl2N5S — CID 100782129
1-[(2-chlorophenyl)methyl]-3-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100782129) has the molecular formula C17H19Cl2N5S and a molecular weight of 396.35 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100782129 |
| Molecular Formula | C17H19Cl2N5S |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(4-chloro-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCc1ccccc1Cl)Nc1nc(Cl)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C17H19Cl2N5S/c18-13-7-3-2-6-12(13)11-20-17(25)23-16-21-14(19)10-15(22-16)24-8-4-1-5-9-24/h2-3,6-7,10H,1,4-5,8-9,11H2,(H2,20,21,22,23,25) |
| InChIKey | DKOLMXRLYMBMHT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|