C24H33ClN6S — CID 100782030
1-[4,6-bis(azepan-1-yl)pyrimidin-2-yl]-3-[(2-chlorophenyl)methyl]thiourea (PubChem CID 100782030) has the molecular formula C24H33ClN6S and a molecular weight of 473.09 g/mol. Its IUPAC name is 1-[4,6-bis(azepan-1-yl)pyrimidin-2-yl]-3-[(2-chlorophenyl)methyl]thiourea.
| Compound Name | 1-[4,6-bis(azepan-1-yl)pyrimidin-2-yl]-3-[(2-chlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100782030 |
| Molecular Formula | C24H33ClN6S |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[4,6-bis(azepan-1-yl)pyrimidin-2-yl]-3-[(2-chlorophenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccccc1Cl)Nc1nc(N2CCCCCC2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C24H33ClN6S/c25-20-12-6-5-11-19(20)18-26-24(32)29-23-27-21(30-13-7-1-2-8-14-30)17-22(28-23)31-15-9-3-4-10-16-31/h5-6,11-12,17H,1-4,7-10,13-16,18H2,(H2,26,27,28,29,32) |
| InChIKey | GJGXLJDCKRJEGR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|