C20H26ClN5S — CID 100782062
1-[(2-chlorophenyl)methyl]-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100782062) has the molecular formula C20H26ClN5S and a molecular weight of 403.98 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100782062 |
| Molecular Formula | C20H26ClN5S |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2C[C@H](C)C[C@@H](C)C2)nc(NC(=S)NCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H26ClN5S/c1-13-8-14(2)12-26(11-13)18-9-15(3)23-19(24-18)25-20(27)22-10-16-6-4-5-7-17(16)21/h4-7,9,13-14H,8,10-12H2,1-3H3,(H2,22,23,24,25,27)/t13-,14-/m1/s1 |
| InChIKey | IJFMMOOTTOXRRE-ZIAGYGMSSA-N |
| XLogP | 4.41 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|