C22H30FN5S — CID 100786114
1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea (PubChem CID 100786114) has the molecular formula C22H30FN5S and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea.
| Compound Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100786114 |
| Molecular Formula | C22H30FN5S |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
| SMILES | Cc1cc(N2C[C@H](C)C[C@H](C)C2)nc(NC(=S)NCCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H30FN5S/c1-15-11-16(2)14-28(13-15)20-12-17(3)25-21(26-20)27-22(29)24-10-4-5-18-6-8-19(23)9-7-18/h6-9,12,15-16H,4-5,10-11,13-14H2,1-3H3,(H2,24,25,26,27,29)/t15-,16+ |
| InChIKey | QFVYOAAECPRGIF-IYBDPMFKSA-N |
| XLogP | 4.33 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|