C21H28FN5S — CID 100786106
1-[3-(4-fluorophenyl)propyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100786106) has the molecular formula C21H28FN5S and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)propyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100786106 |
| Molecular Formula | C21H28FN5S |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCC(C)CC2)nc(NC(=S)NCCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H28FN5S/c1-15-9-12-27(13-10-15)19-14-16(2)24-20(25-19)26-21(28)23-11-3-4-17-5-7-18(22)8-6-17/h5-8,14-15H,3-4,9-13H2,1-2H3,(H2,23,24,25,26,28) |
| InChIKey | NXYKXTCPCHNOIF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|