C26H37FN6S — CID 100785983
1-[3-(4-fluorophenyl)propyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100785983) has the molecular formula C26H37FN6S and a molecular weight of 484.69 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)propyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100785983 |
| Molecular Formula | C26H37FN6S |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCC[C@@H]3C)nc(NC(=S)NCCCc3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C26H37FN6S/c1-19-7-6-15-32(18-19)23-17-24(33-16-4-3-8-20(33)2)30-25(29-23)31-26(34)28-14-5-9-21-10-12-22(27)13-11-21/h10-13,17,19-20H,3-9,14-16,18H2,1-2H3,(H2,28,29,30,31,34)/t19-,20+/m1/s1 |
| InChIKey | RECYGUPZUJVAFS-UXHICEINSA-N |
| XLogP | 5.15 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|