C24H33FN6S — CID 100785867
1-[4-(azepan-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea (PubChem CID 100785867) has the molecular formula C24H33FN6S and a molecular weight of 456.64 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100785867 |
| Molecular Formula | C24H33FN6S |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
| SMILES | Fc1ccc(CCCNC(=S)Nc2nc(N3CCCCCC3)cc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C24H33FN6S/c25-20-11-9-19(10-12-20)8-7-13-26-24(32)29-23-27-21(30-14-3-1-2-4-15-30)18-22(28-23)31-16-5-6-17-31/h9-12,18H,1-8,13-17H2,(H2,26,27,28,29,32) |
| InChIKey | ODJOCBMVYKXWTN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|