C21H29N5OS — CID 100785407
1-[4-(azepan-1-yl)-6-methoxypyrimidin-2-yl]-3-(3-phenylpropyl)thiourea (PubChem CID 100785407) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-methoxypyrimidin-2-yl]-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-methoxypyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785407 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-methoxypyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
| SMILES | COc1cc(N2CCCCCC2)nc(NC(=S)NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C21H29N5OS/c1-27-19-16-18(26-14-7-2-3-8-15-26)23-20(24-19)25-21(28)22-13-9-12-17-10-5-4-6-11-17/h4-6,10-11,16H,2-3,7-9,12-15H2,1H3,(H2,22,23,24,25,28) |
| InChIKey | ZEOIPNWMLUCMMG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|