C27H33N7OS — CID 100783775
1-[4-methoxy-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 100783775) has the molecular formula C27H33N7OS and a molecular weight of 503.68 g/mol. Its IUPAC name is 1-[4-methoxy-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-methoxy-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783775 |
| Molecular Formula | C27H33N7OS |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 1-[4-methoxy-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | COc1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)NCc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C27H33N7OS/c1-35-25-19-24(34-17-15-33(16-18-34)22-7-3-2-4-8-22)29-26(30-25)31-27(36)28-20-21-9-11-23(12-10-21)32-13-5-6-14-32/h2-4,7-12,19H,5-6,13-18,20H2,1H3,(H2,28,29,30,31,36) |
| InChIKey | KYWXCDCWWAFRFI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|