C28H34N6OS — CID 100784112
1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 100784112) has the molecular formula C28H34N6OS and a molecular weight of 502.69 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100784112 |
| Molecular Formula | C28H34N6OS |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | CC1CCN(c2cc(Oc3ccccc3)nc(NC(=S)NCc3ccc(N4CCCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C28H34N6OS/c1-21-13-17-34(18-14-21)25-19-26(35-24-7-3-2-4-8-24)31-27(30-25)32-28(36)29-20-22-9-11-23(12-10-22)33-15-5-6-16-33/h2-4,7-12,19,21H,5-6,13-18,20H2,1H3,(H2,29,30,31,32,36) |
| InChIKey | YEFXUXVYDJEMBG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|