C28H29N5O2S — CID 100779508
1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779508) has the molecular formula C28H29N5O2S and a molecular weight of 499.64 g/mol. Its IUPAC name is 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779508 |
| Molecular Formula | C28H29N5O2S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 1-[4-(4-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | CC1CCN(c2cc(Oc3ccccc3)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)CC1 |
| InChI | InChI=1S/C28H29N5O2S/c1-20-14-16-33(17-15-20)25-18-26(35-22-10-6-3-7-11-22)31-27(30-25)32-28(36)29-19-23-12-13-24(34-23)21-8-4-2-5-9-21/h2-13,18,20H,14-17,19H2,1H3,(H2,29,30,31,32,36) |
| InChIKey | KAAFFSFDXSQOJY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|