C28H28ClN5O2S — CID 100780068
1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea (PubChem CID 100780068) has the molecular formula C28H28ClN5O2S and a molecular weight of 534.09 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100780068 |
| Molecular Formula | C28H28ClN5O2S |
| Molecular Weight | 534.09 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-phenoxypyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
| SMILES | S=C(NCc1ccc(-c2ccc(Cl)cc2)o1)Nc1nc(Oc2ccccc2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C28H28ClN5O2S/c29-21-12-10-20(11-13-21)24-15-14-23(35-24)19-30-28(37)33-27-31-25(34-16-6-1-2-7-17-34)18-26(32-27)36-22-8-4-3-5-9-22/h3-5,8-15,18H,1-2,6-7,16-17,19H2,(H2,30,31,32,33,37) |
| InChIKey | ZPVAPANJHLNUQF-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.09 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|