C21H19ClF3N5OS — CID 100780123
1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100780123) has the molecular formula C21H19ClF3N5OS and a molecular weight of 481.93 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100780123 |
| Molecular Formula | C21H19ClF3N5OS |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCCC2)nc(NC(=S)NCc2ccc(-c3ccc(Cl)cc3)o2)n1 |
| InChI | InChI=1S/C21H19ClF3N5OS/c22-14-5-3-13(4-6-14)16-8-7-15(31-16)12-26-20(32)29-19-27-17(21(23,24)25)11-18(28-19)30-9-1-2-10-30/h3-8,11H,1-2,9-10,12H2,(H2,26,27,28,29,32) |
| InChIKey | LDUKROFPVZEUKJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|