C22H25ClF3N5OS — CID 100789694
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100789694) has the molecular formula C22H25ClF3N5OS and a molecular weight of 499.99 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789694 |
| Molecular Formula | C22H25ClF3N5OS |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCCC2)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C22H25ClF3N5OS/c23-16-5-3-15(4-6-16)21(7-11-32-12-8-21)14-27-20(33)30-19-28-17(22(24,25)26)13-18(29-19)31-9-1-2-10-31/h3-6,13H,1-2,7-12,14H2,(H2,27,28,29,30,33) |
| InChIKey | JQTGJOFMFPQKMW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|