C28H31F3N6OS — CID 100789442
1-[(4-phenyloxan-4-yl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100789442) has the molecular formula C28H31F3N6OS and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-[(4-phenyloxan-4-yl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-phenyloxan-4-yl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789442 |
| Molecular Formula | C28H31F3N6OS |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 1-[(4-phenyloxan-4-yl)methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C28H31F3N6OS/c29-28(30,31)23-19-24(37-15-13-36(14-16-37)22-9-5-2-6-10-22)34-25(33-23)35-26(39)32-20-27(11-17-38-18-12-27)21-7-3-1-4-8-21/h1-10,19H,11-18,20H2,(H2,32,33,34,35,39) |
| InChIKey | CILPTFXZUVVKKP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|