C23H23ClF3N5OS — CID 133260436
1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 133260436) has the molecular formula C23H23ClF3N5OS and a molecular weight of 509.99 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133260436 |
| Molecular Formula | C23H23ClF3N5OS |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(C(F)(F)F)nc(NC(=S)NCc3ccc(-c4ccc(Cl)cc4)o3)n2)C1 |
| InChI | InChI=1S/C23H23ClF3N5OS/c1-14-3-2-10-32(13-14)20-11-19(23(25,26)27)29-21(30-20)31-22(34)28-12-17-8-9-18(33-17)15-4-6-16(24)7-5-15/h4-9,11,14H,2-3,10,12-13H2,1H3,(H2,28,29,30,31,34) |
| InChIKey | KUVNBFWVNFBYJO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|