C23H25Cl2N5OS — CID 100780196
1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea (PubChem CID 100780196) has the molecular formula C23H25Cl2N5OS and a molecular weight of 490.46 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100780196 |
| Molecular Formula | C23H25Cl2N5OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(Cl)nc(NC(=S)NCc3ccc(-c4ccc(Cl)cc4)o3)n2)C1 |
| InChI | InChI=1S/C23H25Cl2N5OS/c1-14-9-15(2)13-30(12-14)21-10-20(25)27-22(28-21)29-23(32)26-11-18-7-8-19(31-18)16-3-5-17(24)6-4-16/h3-8,10,14-15H,9,11-13H2,1-2H3,(H2,26,27,28,29,32)/t14-,15-/m1/s1 |
| InChIKey | MMZICXWFOALEOU-HUUCEWRRSA-N |
| XLogP | 6.01 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|