C23H26ClN5OS — CID 100779751
1-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779751) has the molecular formula C23H26ClN5OS and a molecular weight of 456.02 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779751 |
| Molecular Formula | C23H26ClN5OS |
| Molecular Weight | 456.02 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(Cl)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)C1 |
| InChI | InChI=1S/C23H26ClN5OS/c1-15-10-16(2)14-29(13-15)21-11-20(24)26-22(27-21)28-23(31)25-12-18-8-9-19(30-18)17-6-4-3-5-7-17/h3-9,11,15-16H,10,12-14H2,1-2H3,(H2,25,26,27,28,31)/t15-,16-/m0/s1 |
| InChIKey | CERWILRFCRAVGB-HOTGVXAUSA-N |
| XLogP | 5.36 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.02 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|