C25H29ClN6OS — CID 100779813
1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100779813) has the molecular formula C25H29ClN6OS and a molecular weight of 497.07 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100779813 |
| Molecular Formula | C25H29ClN6OS |
| Molecular Weight | 497.07 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCc1ccc(-c2ccc(Cl)cc2)o1)Nc1nc(N2CCCCC2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C25H29ClN6OS/c26-19-8-6-18(7-9-19)21-11-10-20(33-21)17-27-25(34)30-24-28-22(31-12-2-1-3-13-31)16-23(29-24)32-14-4-5-15-32/h6-11,16H,1-5,12-15,17H2,(H2,27,28,29,30,34) |
| InChIKey | HYIDQJZDQOYBPT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.07 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|