C21H14ClF3N6OS2 — CID 100780168
1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100780168) has the molecular formula C21H14ClF3N6OS2 and a molecular weight of 522.97 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100780168 |
| Molecular Formula | C21H14ClF3N6OS2 |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)furan-2-yl]methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(Sc2ncccn2)nc(NC(=S)NCc2ccc(-c3ccc(Cl)cc3)o2)n1 |
| InChI | InChI=1S/C21H14ClF3N6OS2/c22-13-4-2-12(3-5-13)15-7-6-14(32-15)11-28-19(33)31-18-29-16(21(23,24)25)10-17(30-18)34-20-26-8-1-9-27-20/h1-10H,11H2,(H2,28,29,30,31,33) |
| InChIKey | ILIYBZBFWJDXQS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|