C18H15F3N6S2 — CID 100783111
1-[(4-methylphenyl)methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100783111) has the molecular formula C18H15F3N6S2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100783111 |
| Molecular Formula | C18H15F3N6S2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-[4-pyrimidin-2-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H15F3N6S2/c1-11-3-5-12(6-4-11)10-24-16(28)27-15-25-13(18(19,20)21)9-14(26-15)29-17-22-7-2-8-23-17/h2-9H,10H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | TXLBGBKRDLYNKO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|