C28H36N6OS — CID 100779493
1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779493) has the molecular formula C28H36N6OS and a molecular weight of 504.70 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779493 |
| Molecular Formula | C28H36N6OS |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | CC1CCN(c2cc(N3CCCC[C@@H]3C)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)CC1 |
| InChI | InChI=1S/C28H36N6OS/c1-20-13-16-33(17-14-20)25-18-26(34-15-7-6-8-21(34)2)31-27(30-25)32-28(36)29-19-23-11-12-24(35-23)22-9-4-3-5-10-22/h3-5,9-12,18,20-21H,6-8,13-17,19H2,1-2H3,(H2,29,30,31,32,36)/t21-/m0/s1 |
| InChIKey | ORVCMMMWEJRDMB-NRFANRHFSA-N |
| XLogP | 5.84 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|