C33H44N8S — CID 133197337
1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 133197337) has the molecular formula C33H44N8S and a molecular weight of 584.84 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 133197337 |
| Molecular Formula | C33H44N8S |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccc(N4CCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C33H44N8S/c1-25-20-26(2)24-41(23-25)31-21-30(40-18-16-39(17-19-40)28-8-4-3-5-9-28)35-32(36-31)37-33(42)34-22-27-10-12-29(13-11-27)38-14-6-7-15-38/h3-5,8-13,21,25-26H,6-7,14-20,22-24H2,1-2H3,(H2,34,35,36,37,42) |
| InChIKey | VEESYYSYBSJYMB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|