C30H39N7S — CID 100782824
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea (PubChem CID 100782824) has the molecular formula C30H39N7S and a molecular weight of 529.76 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100782824 |
| Molecular Formula | C30H39N7S |
| Molecular Weight | 529.76 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(N3CCN(c4ccccc4)CC3)cc(N3C[C@H](C)C[C@@H](C)C3)n2)cc1 |
| InChI | InChI=1S/C30H39N7S/c1-22-9-11-25(12-10-22)19-31-30(38)34-29-32-27(18-28(33-29)37-20-23(2)17-24(3)21-37)36-15-13-35(14-16-36)26-7-5-4-6-8-26/h4-12,18,23-24H,13-17,19-21H2,1-3H3,(H2,31,32,33,34,38)/t23-,24-/m1/s1 |
| InChIKey | YSRPCYNOZIVJEC-DNQXCXABSA-N |
| XLogP | 5.08 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|