C26H37N7S — CID 133197312
1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 133197312) has the molecular formula C26H37N7S and a molecular weight of 479.70 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 133197312 |
| Molecular Formula | C26H37N7S |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCCC3)nc(NC(=S)NCc3ccc(N4CCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C26H37N7S/c1-20-7-6-16-33(19-20)24-17-23(32-14-4-5-15-32)28-25(29-24)30-26(34)27-18-21-8-10-22(11-9-21)31-12-2-3-13-31/h8-11,17,20H,2-7,12-16,18-19H2,1H3,(H2,27,28,29,30,34) |
| InChIKey | IEYVNVCTFWXQJV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|