C20H27N5OS — CID 125048115
1-[4-[(3S)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]-3-propylthiourea (PubChem CID 125048115) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]-3-propylthiourea.
| Compound Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]-3-propylthiourea |
|---|---|
| PubChem CID | 125048115 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1nc(Oc2ccccc2)cc(N2CCC[C@H](C)C2)n1 |
| InChI | InChI=1S/C20H27N5OS/c1-3-11-21-20(27)24-19-22-17(25-12-7-8-15(2)14-25)13-18(23-19)26-16-9-5-4-6-10-16/h4-6,9-10,13,15H,3,7-8,11-12,14H2,1-2H3,(H2,21,22,23,24,27)/t15-/m0/s1 |
| InChIKey | FRLRGZCSUFFBSI-HNNXBMFYSA-N |
| XLogP | 4.20 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|