C32H35FN8S — CID 100783437
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 100783437) has the molecular formula C32H35FN8S and a molecular weight of 582.75 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783437 |
| Molecular Formula | C32H35FN8S |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)Nc2nc(N3CCN(c4ccccc4)CC3)cc(N3CCN(c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C32H35FN8S/c33-26-13-11-25(12-14-26)24-34-32(42)37-31-35-29(40-19-15-38(16-20-40)27-7-3-1-4-8-27)23-30(36-31)41-21-17-39(18-22-41)28-9-5-2-6-10-28/h1-14,23H,15-22,24H2,(H2,34,35,36,37,42) |
| InChIKey | AGKURTKKNNSUHW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|