C34H39FN8S — CID 100786048
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea (PubChem CID 100786048) has the molecular formula C34H39FN8S and a molecular weight of 610.81 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100786048 |
| Molecular Formula | C34H39FN8S |
| Molecular Weight | 610.81 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[3-(4-fluorophenyl)propyl]thiourea |
| SMILES | Fc1ccc(CCCNC(=S)Nc2nc(N3CCN(c4ccccc4)CC3)cc(N3CCN(c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C34H39FN8S/c35-28-15-13-27(14-16-28)8-7-17-36-34(44)39-33-37-31(42-22-18-40(19-23-42)29-9-3-1-4-10-29)26-32(38-33)43-24-20-41(21-25-43)30-11-5-2-6-12-30/h1-6,9-16,26H,7-8,17-25H2,(H2,36,37,38,39,44) |
| InChIKey | NAPUGDJKGHYRNG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|