C19H21F4N5S — CID 100786137
1-[3-(4-fluorophenyl)propyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100786137) has the molecular formula C19H21F4N5S and a molecular weight of 427.47 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)propyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100786137 |
| Molecular Formula | C19H21F4N5S |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-[3-(4-fluorophenyl)propyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | Fc1ccc(CCCNC(=S)Nc2nc(N3CCCC3)cc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H21F4N5S/c20-14-7-5-13(6-8-14)4-3-9-24-18(29)27-17-25-15(19(21,22)23)12-16(26-17)28-10-1-2-11-28/h5-8,12H,1-4,9-11H2,(H2,24,25,26,27,29) |
| InChIKey | YHTCZTKUUSCADG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|