C21H26F3N5S — CID 100785720
1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea (PubChem CID 100785720) has the molecular formula C21H26F3N5S and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785720 |
| Molecular Formula | C21H26F3N5S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-(3-phenylpropyl)thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(C(F)(F)F)nc(NC(=S)NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C21H26F3N5S/c1-15-8-5-6-13-29(15)18-14-17(21(22,23)24)26-19(27-18)28-20(30)25-12-7-11-16-9-3-2-4-10-16/h2-4,9-10,14-15H,5-8,11-13H2,1H3,(H2,25,26,27,28,30)/t15-/m1/s1 |
| InChIKey | KDQAMVTUBLHYLD-OAHLLOKOSA-N |
| XLogP | 4.79 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|