C20H22F3N5O2S — CID 133180187
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 133180187) has the molecular formula C20H22F3N5O2S and a molecular weight of 453.49 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133180187 |
| Molecular Formula | C20H22F3N5O2S |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(2-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCCCN1c1cc(C(F)(F)F)nc(NC(=S)NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C20H22F3N5O2S/c1-12-4-2-3-7-28(12)17-9-16(20(21,22)23)25-18(26-17)27-19(31)24-10-13-5-6-14-15(8-13)30-11-29-14/h5-6,8-9,12H,2-4,7,10-11H2,1H3,(H2,24,25,26,27,31) |
| InChIKey | NRYDPEDLMNLNAN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|