C15H22F3N5S — CID 125048666
1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-propan-2-ylthiourea (PubChem CID 125048666) has the molecular formula C15H22F3N5S and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 125048666 |
| Molecular Formula | C15H22F3N5S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[4-[(2R)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1nc(N2CCCC[C@H]2C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H22F3N5S/c1-9(2)19-14(24)22-13-20-11(15(16,17)18)8-12(21-13)23-7-5-4-6-10(23)3/h8-10H,4-7H2,1-3H3,(H2,19,20,21,22,24)/t10-/m1/s1 |
| InChIKey | QTQOKIVOSZQJDV-SNVBAGLBSA-N |
| XLogP | 3.57 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|