C15H25N5S — CID 125048132
1-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-propan-2-ylthiourea (PubChem CID 125048132) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 1-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 125048132 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-[4-methyl-6-[(2R)-2-methylpiperidin-1-yl]pyrimidin-2-yl]-3-propan-2-ylthiourea |
| SMILES | Cc1cc(N2CCCC[C@H]2C)nc(NC(=S)NC(C)C)n1 |
| InChI | InChI=1S/C15H25N5S/c1-10(2)16-15(21)19-14-17-11(3)9-13(18-14)20-8-6-5-7-12(20)4/h9-10,12H,5-8H2,1-4H3,(H2,16,17,18,19,21)/t12-/m1/s1 |
| InChIKey | GFCLQAFJZMVQBF-GFCCVEGCSA-N |
| XLogP | 2.86 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|