C18H25N5OS — CID 133254636
1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133254636) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133254636 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCCCC2C)nc(NC(=S)NCc2ccc(C)o2)n1 |
| InChI | InChI=1S/C18H25N5OS/c1-12-10-16(23-9-5-4-6-13(23)2)21-17(20-12)22-18(25)19-11-15-8-7-14(3)24-15/h7-8,10,13H,4-6,9,11H2,1-3H3,(H2,19,20,21,22,25) |
| InChIKey | AFRSVAHLSJFYCK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|