C18H22F3N5OS — CID 100779240
1-[(5-methylfuran-2-yl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100779240) has the molecular formula C18H22F3N5OS and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100779240 |
| Molecular Formula | C18H22F3N5OS |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(N3CCCC[C@@H]3C)cc(C(F)(F)F)n2)o1 |
| InChI | InChI=1S/C18H22F3N5OS/c1-11-5-3-4-8-26(11)15-9-14(18(19,20)21)23-16(24-15)25-17(28)22-10-13-7-6-12(2)27-13/h6-7,9,11H,3-5,8,10H2,1-2H3,(H2,22,23,24,25,28)/t11-/m0/s1 |
| InChIKey | QHPSSUPTEFTKNU-NSHDSACASA-N |
| XLogP | 4.26 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|