C17H24F3N5OS — CID 100778382
1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778382) has the molecular formula C17H24F3N5OS and a molecular weight of 403.47 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778382 |
| Molecular Formula | C17H24F3N5OS |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(C(F)(F)F)nc(NC(=S)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C17H24F3N5OS/c1-11-5-2-3-7-25(11)14-9-13(17(18,19)20)22-15(23-14)24-16(27)21-10-12-6-4-8-26-12/h9,11-12H,2-8,10H2,1H3,(H2,21,22,23,24,27)/t11-,12-/m0/s1 |
| InChIKey | ZDBXZLDPJMEAQF-RYUDHWBXSA-N |
| XLogP | 3.34 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|