C15H20F3N5OS — CID 100778352
1-[[(2S)-oxolan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100778352) has the molecular formula C15H20F3N5OS and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100778352 |
| Molecular Formula | C15H20F3N5OS |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[4-pyrrolidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCCC2)nc(NC(=S)NC[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C15H20F3N5OS/c16-15(17,18)11-8-12(23-5-1-2-6-23)21-13(20-11)22-14(25)19-9-10-4-3-7-24-10/h8,10H,1-7,9H2,(H2,19,20,21,22,25)/t10-/m0/s1 |
| InChIKey | JIFXXZRCWNDKQL-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|